CAS 1289385-43-8

Benzonitrile, 2-[(4-piperidinylamino)methyl]-, hydrochloride (1:1)

Description:

Benzonitrile, 2-[(4-piperidinylamino)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzonitrile moiety and a piperidine ring. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in pharmaceutical and chemical research. The presence of the piperidinylamino group suggests potential biological activity, possibly as a pharmacological agent. The compound may exhibit properties such as moderate to high polarity due to the nitrile and amine functional groups, influencing its reactivity and interaction with biological systems. Additionally, the hydrochloride form indicates that it can exist as a stable crystalline solid under standard conditions. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in the development of therapeutic agents or as a building block in organic synthesis. As with any chemical, proper handling and safety protocols should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₇N₃·ClH

InChI: InChI=1S/C13H17N3.ClH/c14-9-11-3-1-2-4-12(11)10-16-13-5-7-15-8-6-13;/h1-4,13,15-16H,5-8,10H2;1H

InChI key: InChIKey=CMJIJTKQDDOFCW-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)C2=C(C#N)C=CC=C2.Cl

Synonyms:

• Benzonitrile, 2-[(4-piperidinylamino)methyl]-, hydrochloride (1:1)

2-((Piperidin-4-ylamino)methyl)benzonitrile hydrochloride

CAS: 1289385-43-8

Formula: C₁₃H₁₈ClN₃

Molecular weight: 251.7551

Ref: IN-DA000YKH