
CAS 1289385-44-9
:2,6-Dichloro-N-(1-methylethyl)-4-pyrimidinemethanamine
Description:
2,6-Dichloro-N-(1-methylethyl)-4-pyrimidinemethanamine is a chemical compound characterized by its pyrimidine ring structure, which is substituted at the 2 and 6 positions with chlorine atoms. The presence of the N-(1-methylethyl) group indicates that it has an isopropyl substituent attached to the nitrogen atom, contributing to its overall hydrophobic character. This compound is likely to exhibit properties typical of amines, such as basicity, and may participate in hydrogen bonding due to the amine functional group. Its chlorinated nature suggests potential applications in agrochemicals or pharmaceuticals, as halogenated compounds often exhibit enhanced biological activity. The molecular structure implies that it may have specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of multiple functional groups can influence its solubility, stability, and reactivity, which are critical factors in its application and behavior in various chemical environments.
Formula:C8H11Cl2N3
InChI:InChI=1S/C8H11Cl2N3/c1-5(2)11-4-6-3-7(9)13-8(10)12-6/h3,5,11H,4H2,1-2H3
InChI key:InChIKey=KDCAVQIQICQJFJ-UHFFFAOYSA-N
SMILES:C(NC(C)C)C=1C=C(Cl)N=C(Cl)N1
Synonyms:- 2,6-Dichloro-N-(1-methylethyl)-4-pyrimidinemethanamine
- 4-Pyrimidinemethanamine, 2,6-dichloro-N-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.