CymitQuimica logo

CAS 1289385-46-1

:

2-Piperidinemethanamine, N-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1)

Description:
2-Piperidinemethanamine, N-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential biological activity. The presence of the 2,4-dichlorophenyl group enhances its lipophilicity, potentially influencing its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical formulations. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions, given the structural motifs often associated with such activities. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to regulatory scrutiny depending on its intended use. Safety data sheets would provide information on handling, storage, and potential hazards associated with this compound, emphasizing the importance of proper laboratory practices when working with chemical substances.
Formula:C13H18Cl2N2·ClH
InChI:InChI=1S/C13H18Cl2N2.ClH/c14-11-5-4-10(13(15)7-11)8-16-9-12-3-1-2-6-17-12;/h4-5,7,12,16-17H,1-3,6,8-9H2;1H
InChI key:InChIKey=AFGHRHSPTUJCCO-UHFFFAOYSA-N
SMILES:C(NCC1CCCCN1)C2=C(Cl)C=C(Cl)C=C2.Cl
Synonyms:
  • 2-Piperidinemethanamine, N-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.