
CAS 1289385-55-2
:2-(Bromomethyl)-3-(methylthio)pyrazine
Description:
2-(Bromomethyl)-3-(methylthio)pyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromomethyl group indicates that a bromomethyl substituent is attached to the pyrazine ring, enhancing its reactivity and potential for further chemical modifications. The methylthio group, which consists of a sulfur atom bonded to a methyl group, contributes to the compound's unique properties, including its potential for nucleophilic substitution reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests that it could participate in various chemical reactions, such as electrophilic aromatic substitution or nucleophilic attack, due to the electron-withdrawing nature of the bromine atom and the electron-donating properties of the methylthio group. Overall, 2-(Bromomethyl)-3-(methylthio)pyrazine is a versatile compound with potential applications in synthetic chemistry and medicinal chemistry.
Formula:C6H7BrN2S
InChI:InChI=1S/C6H7BrN2S/c1-10-6-5(4-7)8-2-3-9-6/h2-3H,4H2,1H3
InChI key:InChIKey=ZUYHCRXIYBTZJE-UHFFFAOYSA-N
SMILES:C(Br)C=1C(SC)=NC=CN1
Synonyms:- Pyrazine, 2-(bromomethyl)-3-(methylthio)-
- 2-(Bromomethyl)-3-(methylthio)pyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.