CymitQuimica logo

CAS 1289385-57-4

:

3-Chloro-6-(methoxymethyl)pyridazine

Description:
3-Chloro-6-(methoxymethyl)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a chlorine atom at the 3-position and a methoxymethyl group at the 6-position contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The methoxymethyl group enhances the compound's solubility and may influence its biological activity. This compound is typically synthesized through specific organic reactions that introduce the chlorine and methoxymethyl substituents onto the pyridazine ring. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions of synthesis and purity. As with many halogenated compounds, it may exhibit interesting electronic properties and reactivity patterns, making it a subject of interest in medicinal chemistry and material science. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C6H7ClN2O
InChI:InChI=1S/C6H7ClN2O/c1-10-4-5-2-3-6(7)9-8-5/h2-3H,4H2,1H3
InChI key:InChIKey=PFWSQYLUWCKZJR-UHFFFAOYSA-N
SMILES:C(OC)C1=CC=C(Cl)N=N1
Synonyms:
  • Pyridazine, 3-chloro-6-(methoxymethyl)-
  • 3-Chloro-6-(methoxymethyl)pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.