CymitQuimica logo

CAS 1289385-65-4

:

4-Piperidinemethanamine, 1-[(2-methylphenyl)methyl]-, hydrochloride (1:1)

Description:
4-Piperidinemethanamine, 1-[(2-methylphenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential for forming salts, such as the hydrochloride form. This compound features a side chain that includes a 2-methylphenyl group, which can influence its solubility and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The presence of the piperidine moiety suggests potential activity as a neurotransmitter modulator, which may be relevant in medicinal chemistry. Its molecular structure allows for various functional group interactions, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound's unique structural features and properties make it of interest in both synthetic and medicinal chemistry contexts.
Formula:C14H22N2·ClH
InChI:InChI=1S/C14H22N2.ClH/c1-12-4-2-3-5-14(12)11-16-8-6-13(10-15)7-9-16;/h2-5,13H,6-11,15H2,1H3;1H
InChI key:InChIKey=LNMMPKXUKRVTGQ-UHFFFAOYSA-N
SMILES:C(C1=C(C)C=CC=C1)N2CCC(CN)CC2.Cl
Synonyms:
  • 4-Piperidinemethanamine, 1-[(2-methylphenyl)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.