CymitQuimica logo

CAS 1289385-67-6

:

1,1-Dimethylethyl N-methyl-N-[1-[1-(2-pyrazinyl)ethyl]-4-piperidinyl]carbamate

Description:
1,1-Dimethylethyl N-methyl-N-[1-[1-(2-pyrazinyl)ethyl]-4-piperidinyl]carbamate, identified by its CAS number 1289385-67-6, is a synthetic organic compound characterized by its complex molecular structure. It features a carbamate functional group, which is indicative of its potential use in various chemical applications, including as a pharmaceutical agent. The presence of a piperidine ring suggests that it may exhibit biological activity, potentially interacting with neurotransmitter systems. Additionally, the incorporation of a pyrazine moiety could enhance its pharmacological properties, possibly contributing to its lipophilicity and ability to cross biological membranes. The compound is likely to be a solid at room temperature, with solubility varying based on the solvent used, and it may exhibit moderate stability under standard conditions. Its specific characteristics, such as melting point, boiling point, and reactivity, would require empirical determination through experimental methods. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.
Formula:C17H28N4O2
InChI:InChI=1S/C17H28N4O2/c1-13(15-12-18-8-9-19-15)21-10-6-14(7-11-21)20(5)16(22)23-17(2,3)4/h8-9,12-14H,6-7,10-11H2,1-5H3
InChI key:InChIKey=BMBJOIKANPVNBK-UHFFFAOYSA-N
SMILES:C(C)(N1CCC(N(C(OC(C)(C)C)=O)C)CC1)C=2C=NC=CN2
Synonyms:
  • 1,1-Dimethylethyl N-methyl-N-[1-[1-(2-pyrazinyl)ethyl]-4-piperidinyl]carbamate
  • Carbamic acid, N-methyl-N-[1-[1-(2-pyrazinyl)ethyl]-4-piperidinyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.