CAS 1289385-75-6

2-Pyrazinemethanamine, α-methyl-N-(4-piperidinylmethyl)-, hydrochloride (1:1)

Description:

2-Pyrazinemethanamine, α-methyl-N-(4-piperidinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a pyrazine ring and a piperidine moiety. This substance typically appears as a white to off-white crystalline powder and is soluble in water, indicating its ionic nature due to the hydrochloride salt form. The presence of both the pyrazine and piperidine groups suggests potential biological activity, possibly influencing neurotransmitter systems or exhibiting pharmacological properties. The compound's molecular structure allows for various interactions, making it of interest in medicinal chemistry and drug development. As with many amines, it may exhibit basicity, forming salts with acids, which can enhance its solubility and stability. Safety and handling precautions are essential, as with any chemical substance, particularly those with potential biological activity. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications in therapeutic contexts.

Formula: C₁₂H₂₀N₄·ClH

InChI: InChI=1S/C12H20N4.ClH/c1-10(12-9-14-6-7-15-12)16-8-11-2-4-13-5-3-11;/h6-7,9-11,13,16H,2-5,8H2,1H3;1H

InChI key: InChIKey=AAIARHNAMLBSOW-UHFFFAOYSA-N

SMILES: C(NCC1CCNCC1)(C)C=2C=NC=CN2.Cl

Synonyms:

• 2-Pyrazinemethanamine, α-methyl-N-(4-piperidinylmethyl)-, hydrochloride (1:1)