CAS 1289385-78-9

Piperidine, 3-[[(4-fluorophenyl)thio]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[[(4-fluorophenyl)thio]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a 4-fluorophenylthio group at the 3-position of the piperidine ring contributes to its unique properties, including potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceutical formulations. The fluorine atom in the phenyl group can influence the compound's electronic properties, potentially affecting its interaction with biological targets. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₆FNS·ClH

InChI: InChI=1S/C12H16FNS.ClH/c13-11-3-5-12(6-4-11)15-9-10-2-1-7-14-8-10;/h3-6,10,14H,1-2,7-9H2;1H

InChI key: InChIKey=KOLDOKJVNIYCNZ-UHFFFAOYSA-N

SMILES: S(CC1CCCNC1)C2=CC=C(F)C=C2.Cl

Synonyms:

• Piperidine, 3-[[(4-fluorophenyl)thio]methyl]-, hydrochloride (1:1)

Piperidine, 3-[[(4-fluorophenyl)thio]methyl]-, hydrochloride (1:1)

CAS: 1289385-78-9

Formula: C₁₂H₁₇ClFNS

Purity: 98%

Molecular weight: 261.7865

Ref: IN-DA000YLC

3-(4-Fluoro-phenylsulfanylmethyl)-piperidine hydrochloride

CAS: 1289385-78-9

3-(4-Fluoro-phenylsulfanylmethyl)-piperidine hydrochloride

Molecular weight: 261.79g/mol

Ref: 54-PC408332

3-(4-Fluoro-phenylsulfanylmethyl)-piperidine hydrochloride

CAS: 1289385-78-9

Formula: C₁₂H₁₇ClFNS

Purity: 98%

Molecular weight: 261.78

Ref: 10-F090848