CAS 1289385-99-4

3-Pyridinemethanamine, 6-chloro-N-3-pyrrolidinyl-, hydrochloride (1:1)

Description:

3-Pyridinemethanamine, 6-chloro-N-3-pyrrolidinyl-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a pyridine ring and a pyrrolidine moiety. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the chloro substituent at the 6-position of the pyridine ring contributes to its unique reactivity and potential biological activity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be influenced by the functional groups present, which may affect its binding affinity to biological targets. As with many amines, it may also participate in protonation and deprotonation reactions, impacting its behavior in various chemical environments. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₀H₁₄ClN₃·ClH

InChI: InChI=1S/C10H14ClN3.ClH/c11-10-2-1-8(6-14-10)5-13-9-3-4-12-7-9;/h1-2,6,9,12-13H,3-5,7H2;1H

InChI key: InChIKey=NTPWNWWMZLCTTN-UHFFFAOYSA-N

SMILES: C(NC1CCNC1)C=2C=CC(Cl)=NC2.Cl

Synonyms:

• 3-Pyridinemethanamine, 6-chloro-N-3-pyrrolidinyl-, hydrochloride (1:1)