CAS 1289386-02-2

1,1-Dimethylethyl 4-[1-(2-pyrazinyl)ethyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[1-(2-pyrazinyl)ethyl]-1-piperazinecarboxylate, identified by its CAS number 1289386-02-2, is a chemical compound that features a piperazine ring, which is a six-membered cyclic amine known for its biological activity. This compound includes a dimethyl group and a pyrazine moiety, contributing to its potential pharmacological properties. The presence of the piperazine structure often indicates possible interactions with neurotransmitter receptors, making it of interest in medicinal chemistry. The ester functional group in the carboxylate indicates that it may undergo hydrolysis, which can affect its stability and reactivity in biological systems. Additionally, the presence of the 2-pyrazinyl group suggests potential applications in the development of pharmaceuticals, particularly in targeting central nervous system disorders. Overall, this compound's unique structural features may provide avenues for further research into its biological activity and therapeutic potential.

Formula: C₁₅H₂₄N₄O₂

InChI: InChI=1S/C15H24N4O2/c1-12(13-11-16-5-6-17-13)18-7-9-19(10-8-18)14(20)21-15(2,3)4/h5-6,11-12H,7-10H2,1-4H3

InChI key: InChIKey=DLFOFLDVBHZMSL-UHFFFAOYSA-N

SMILES: C(C)(N1CCN(C(OC(C)(C)C)=O)CC1)C=2C=NC=CN2

Synonyms:

• 1-Piperazinecarboxylic acid, 4-[1-(2-pyrazinyl)ethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[1-(2-pyrazinyl)ethyl]-1-piperazinecarboxylate