CAS 1289386-03-3
:1-[(3,4-Dichlorophenyl)methyl]-4-piperidinemethanol
Description:
1-[(3,4-Dichlorophenyl)methyl]-4-piperidinemethanol, identified by its CAS number 1289386-03-3, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with a 3,4-dichlorobenzyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the dichlorophenyl moiety suggests that it may interact with various biological targets, potentially influencing its pharmacological profile. The hydroxymethyl group can enhance solubility and reactivity, making it a candidate for further chemical modifications. Additionally, the compound's structural features may impart specific characteristics such as lipophilicity and polarity, which are crucial for its behavior in biological systems. Overall, this compound's unique structure positions it as a subject of interest in medicinal chemistry and pharmacology, warranting further investigation into its potential applications and effects.
Formula:C13H17Cl2NO
InChI:InChI=1S/C13H17Cl2NO/c14-12-2-1-11(7-13(12)15)8-16-5-3-10(9-17)4-6-16/h1-2,7,10,17H,3-6,8-9H2
InChI key:InChIKey=LUFVHDFFCYFDRM-UHFFFAOYSA-N
SMILES:C(C1=CC(Cl)=C(Cl)C=C1)N2CCC(CO)CC2
Synonyms:- 1-[(3,4-Dichlorophenyl)methyl]-4-piperidinemethanol
- 4-Piperidinemethanol, 1-[(3,4-dichlorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.