CAS 1289386-13-5

Piperidine, 4-[[(2,6-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[(2,6-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 2,6-dichlorophenyl group indicates that the compound has significant lipophilicity, which may influence its biological activity and solubility properties. The methoxy group attached to the phenyl ring suggests potential for various chemical interactions, including hydrogen bonding and electron donation. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for pharmaceutical applications. The compound may exhibit various pharmacological properties, potentially acting as a ligand for certain receptors or enzymes. However, specific biological activities, toxicity, and safety profiles would require further investigation through empirical studies. Overall, this compound's unique structure and functional groups contribute to its potential utility in medicinal chemistry and drug development.

Formula: C₁₃H₁₇Cl₂NO·ClH

InChI: InChI=1S/C13H17Cl2NO.ClH/c14-12-2-1-3-13(15)11(12)9-17-8-10-4-6-16-7-5-10;/h1-3,10,16H,4-9H2;1H

InChI key: InChIKey=ZSWGRGBDLOAKAE-UHFFFAOYSA-N

SMILES: C(OCC1CCNCC1)C2=C(Cl)C=CC=C2Cl.Cl

Synonyms:

• Piperidine, 4-[[(2,6-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)