CAS 1289386-14-6
:trans-4-[[2-(Methylthio)-4-pyrimidinyl]amino]cyclohexanol
Description:
Trans-4-[[2-(Methylthio)-4-pyrimidinyl]amino]cyclohexanol is a chemical compound characterized by its unique structural features, which include a cyclohexanol ring and a pyrimidine moiety substituted with a methylthio group. This compound is classified as an amino alcohol, indicating the presence of both an amino group and a hydroxyl group in its structure. The trans configuration suggests that the substituents on the cyclohexanol ring are oriented in a specific geometric arrangement, which can influence its biological activity and interactions. The methylthio group enhances the compound's lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions with biological targets would depend on the conformation and electronic properties imparted by its functional groups. As with many chemical substances, safety and handling precautions should be observed, given the potential for biological activity.
Formula:C11H17N3OS
InChI:InChI=1/C11H17N3OS/c1-16-11-12-7-6-10(14-11)13-8-2-4-9(15)5-3-8/h6-9,15H,2-5H2,1H3,(H,12,13,14)/t8-,9-
InChI key:InChIKey=ODFSDGGAZHZORF-KYZUINATNA-N
SMILES:N(C1=NC(SC)=NC=C1)[C@@H]2CC[C@@H](O)CC2
Synonyms:- trans-4-[[2-(Methylthio)-4-pyrimidinyl]amino]cyclohexanol
- Cyclohexanol, 4-[[2-(methylthio)-4-pyrimidinyl]amino]-, trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.