
CAS 1289386-19-1
:4-Piperidinamine, N-methyl-1-(3-methyl-2-pyrazinyl)-, hydrochloride (1:1)
Description:
4-Piperidinamine, N-methyl-1-(3-methyl-2-pyrazinyl)-, hydrochloride (1:1), with CAS number 1289386-19-1, is a chemical compound characterized by its piperidine and pyrazine moieties. This substance typically appears as a hydrochloride salt, which enhances its solubility in water and other polar solvents. The presence of the piperidine ring contributes to its potential as a pharmacological agent, as piperidine derivatives are often associated with various biological activities. The N-methyl group and the 3-methyl-2-pyrazinyl substituent may influence its lipophilicity and receptor binding properties. The compound's hydrochloride form indicates that it is likely to be a stable, crystalline solid under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. However, detailed studies on its pharmacodynamics, toxicity, and specific applications would be necessary to fully understand its characteristics and potential uses in research or industry.
Formula:C11H18N4·ClH
InChI:InChI=1S/C11H18N4.ClH/c1-9-11(14-6-5-13-9)15-7-3-10(12-2)4-8-15;/h5-6,10,12H,3-4,7-8H2,1-2H3;1H
InChI key:InChIKey=QMKCJSVONUWEHJ-UHFFFAOYSA-N
SMILES:CC=1C(=NC=CN1)N2CCC(NC)CC2.Cl
Synonyms:- 4-Piperidinamine, N-methyl-1-(3-methyl-2-pyrazinyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.