CAS 1289386-31-7
:2-Chloro-N-cyclopropyl-4-pyrimidinemethanamine
Description:
2-Chloro-N-cyclopropyl-4-pyrimidinemethanamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the second position and a cyclopropyl group attached to the nitrogen atom contributes to its unique reactivity and potential biological activity. This compound is typically classified as an amine due to the presence of the amine functional group (-NH2), which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's solubility, stability, and interaction with biological systems would depend on its specific molecular interactions, making it a subject of interest for further research in drug design and development. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological properties, warranting investigation into its efficacy and safety profiles.
Formula:C8H10ClN3
InChI:InChI=1S/C8H10ClN3/c9-8-10-4-3-7(12-8)5-11-6-1-2-6/h3-4,6,11H,1-2,5H2
InChI key:InChIKey=XEJWSLRUNWUNGQ-UHFFFAOYSA-N
SMILES:N(CC1=NC(Cl)=NC=C1)C2CC2
Synonyms:- N-[(2-Chloropyrimidin-4-yl)methyl]cyclopropanamine
- 2-Chloro-N-cyclopropyl-4-pyrimidinemethanamine
- 4-Pyrimidinemethanamine, 2-chloro-N-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
