CymitQuimica logo

CAS 1289386-37-3

:

2-Bromo-N-ethyl-4-pyridinemethanamine

Description:
2-Bromo-N-ethyl-4-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the second position of the pyridine ring and an ethyl group attached to the nitrogen atom contributes to its unique properties. This compound is likely to exhibit basicity due to the nitrogen atom in the pyridine ring, which can accept protons. The bromine substituent may influence its reactivity, making it a potential candidate for nucleophilic substitution reactions. Additionally, the structure suggests that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the amine and the aromatic system. Its solubility and stability in various solvents can vary, depending on the specific conditions and the presence of other functional groups. Overall, 2-Bromo-N-ethyl-4-pyridinemethanamine is a compound of interest for further research in organic synthesis and drug development.
Formula:C8H11BrN2
InChI:InChI=1S/C8H11BrN2/c1-2-10-6-7-3-4-11-8(9)5-7/h3-5,10H,2,6H2,1H3
InChI key:InChIKey=BZPXBKRCCXUABA-UHFFFAOYSA-N
SMILES:C(NCC)C=1C=C(Br)N=CC1
Synonyms:
  • 4-Pyridinemethanamine, 2-bromo-N-ethyl-
  • 2-Bromo-N-ethyl-4-pyridinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.