CymitQuimica logo

CAS 1289386-42-0

:

Piperidine, 2-[[(2,5-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:
Piperidine, 2-[[(2,5-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a 2,5-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, which can influence its biological activity and lipophilicity. The methoxy group attached to the phenyl ring enhances its reactivity and solubility in organic solvents. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit pharmacological properties, potentially acting as a ligand for certain receptors or enzymes. Its specific interactions and effects would depend on the molecular structure and the presence of functional groups, which can affect its binding affinity and biological activity. Safety and handling precautions should be observed due to the presence of chlorine substituents, which can pose toxicity risks.
Formula:C13H17Cl2NO·ClH
InChI:InChI=1S/C13H17Cl2NO.ClH/c14-11-4-5-13(15)10(7-11)8-17-9-12-3-1-2-6-16-12;/h4-5,7,12,16H,1-3,6,8-9H2;1H
InChI key:InChIKey=NZJDDYZURJEAMB-UHFFFAOYSA-N
SMILES:C(OCC1CCCCN1)C2=C(Cl)C=CC(Cl)=C2.Cl
Synonyms:
  • Piperidine, 2-[[(2,5-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)
Found 2 products.