
CAS 1289386-44-2
:Piperidine, 3-[(2-chloro-6-fluorophenyl)methoxy]-, hydrochloride (1:1)
Description:
Piperidine, 3-[(2-chloro-6-fluorophenyl)methoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a methoxy group attached to the piperidine at the 3-position, along with a 2-chloro-6-fluorophenyl substituent, contributes to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, potentially acting as a ligand for certain receptors or enzymes, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it could be involved in interactions relevant to medicinal chemistry, particularly in the development of therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H15ClFNO·ClH
InChI:InChI=1S/C12H15ClFNO.ClH/c13-11-4-1-5-12(14)10(11)8-16-9-3-2-6-15-7-9;/h1,4-5,9,15H,2-3,6-8H2;1H
InChI key:InChIKey=IMDYMSIGKLSWEA-UHFFFAOYSA-N
SMILES:C(OC1CCCNC1)C2=C(Cl)C=CC=C2F.Cl
Synonyms:- Piperidine, 3-[(2-chloro-6-fluorophenyl)methoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.