
CAS 1289386-52-2
:3-Piperidinamine, 1-[(2,4-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1)
Description:
3-Piperidinamine, 1-[(2,4-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a dichlorophenyl group indicates that the compound has two chlorine atoms substituted on a phenyl ring, specifically at the 2 and 4 positions, contributing to its lipophilicity and potential biological activity. The N-methyl substitution on the piperidine nitrogen enhances its basicity and solubility in polar solvents. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for pharmaceutical applications. This compound may exhibit various pharmacological properties, potentially acting as a ligand for specific receptors or enzymes. Its structure suggests potential uses in medicinal chemistry, particularly in the development of therapeutic agents targeting neurological or psychiatric disorders. However, detailed studies on its efficacy, safety, and mechanism of action would be necessary to fully understand its applications.
Formula:C13H18Cl2N2·ClH
InChI:InChI=1S/C13H18Cl2N2.ClH/c1-16-12-3-2-6-17(9-12)8-10-4-5-11(14)7-13(10)15;/h4-5,7,12,16H,2-3,6,8-9H2,1H3;1H
InChI key:InChIKey=FPHAMBRVCAXZKW-UHFFFAOYSA-N
SMILES:C(C1=C(Cl)C=C(Cl)C=C1)N2CC(NC)CCC2.Cl
Synonyms:- 3-Piperidinamine, 1-[(2,4-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.