CymitQuimica logo

CAS 1289386-54-4

:

6-Chloro-N-cyclopropyl-3-pyridazinemethanamine

Description:
6-Chloro-N-cyclopropyl-3-pyridazinemethanamine is a chemical compound characterized by its unique structure, which includes a pyridazine ring, a cyclopropyl group, and a chloro substituent. The presence of the chloro group typically enhances the compound's reactivity and may influence its biological activity. The cyclopropyl moiety is known for its strain and can impart distinctive properties to the compound, such as increased lipophilicity or altered binding interactions in biological systems. This compound may exhibit potential pharmacological activities, making it of interest in medicinal chemistry and drug development. Its specific interactions and effects would depend on the functional groups and the overall molecular conformation. Additionally, the compound's solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which are relevant in synthetic organic chemistry.
Formula:C8H10ClN3
InChI:InChI=1S/C8H10ClN3/c9-8-4-3-7(11-12-8)5-10-6-1-2-6/h3-4,6,10H,1-2,5H2
InChI key:InChIKey=KSOUYMJPPURPOA-UHFFFAOYSA-N
SMILES:N(CC1=CC=C(Cl)N=N1)C2CC2
Synonyms:
  • 3-Pyridazinemethanamine, 6-chloro-N-cyclopropyl-
  • 6-Chloro-N-cyclopropyl-3-pyridazinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.