CAS 1289386-55-5
:3-Piperidinamine, 1-[(4-methylphenyl)methyl]-, hydrochloride (1:1)
Description:
3-Piperidinamine, 1-[(4-methylphenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a 4-methylphenyl group attached to the piperidinamine, indicating the presence of a methyl group on the phenyl ring, which can influence its physical and chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the amine functional group suggests potential basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the conditions and purity of the sample. Safety data should be consulted for handling and usage guidelines.
Formula:C13H20N2·ClH
InChI:InChI=1S/C13H20N2.ClH/c1-11-4-6-12(7-5-11)9-15-8-2-3-13(14)10-15;/h4-7,13H,2-3,8-10,14H2,1H3;1H
InChI key:InChIKey=JRTHUMGZVAZVSQ-UHFFFAOYSA-N
SMILES:C(N1CC(N)CCC1)C2=CC=C(C)C=C2.Cl
Synonyms:- 3-Piperidinamine, 1-[(4-methylphenyl)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
