CAS 1289386-56-6

6-Chloro-N-ethyl-3-pyridazinemethanamine

Description:

6-Chloro-N-ethyl-3-pyridazinemethanamine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chloro group at the 6-position and an ethyl group attached to the nitrogen atom contributes to its unique reactivity and potential biological activity. This compound may exhibit properties typical of amines, such as basicity and the ability to form salts. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridazine moiety, which is often associated with various biological activities. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in organic synthesis and drug development. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry.

Formula: C₇H₁₀ClN₃

InChI: InChI=1S/C7H10ClN3/c1-2-9-5-6-3-4-7(8)11-10-6/h3-4,9H,2,5H2,1H3

InChI key: InChIKey=ILXGBRVYNHQFOI-UHFFFAOYSA-N

SMILES: C(NCC)C1=CC=C(Cl)N=N1

Synonyms:

• 3-Pyridazinemethanamine, 6-chloro-N-ethyl-
• 6-Chloro-N-ethyl-3-pyridazinemethanamine