CymitQuimica logo

CAS 1289386-63-5

:

6-Chloro-N-(1-methylethyl)-2-(methylsulfinyl)-4-pyrimidinamine

Description:
6-Chloro-N-(1-methylethyl)-2-(methylsulfinyl)-4-pyrimidinamine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing nitrogen atoms. The presence of a chlorine atom at the 6-position and a methylsulfinyl group at the 2-position contributes to its unique reactivity and potential biological activity. The N-(1-methylethyl) substituent indicates the presence of an isopropyl group, which can influence the compound's lipophilicity and interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with various biological pathways. Its CAS number, 1289386-63-5, allows for precise identification in chemical databases and literature. Overall, the combination of halogen, sulfinyl, and amine functionalities suggests potential applications in drug discovery and development, particularly in targeting specific enzymes or receptors in biological systems.
Formula:C8H12ClN3OS
InChI:InChI=1S/C8H12ClN3OS/c1-5(2)10-7-4-6(9)11-8(12-7)14(3)13/h4-5H,1-3H3,(H,10,11,12)
InChI key:InChIKey=LWJZKPVUECZAHC-UHFFFAOYSA-N
SMILES:N(C(C)C)C1=NC(S(C)=O)=NC(Cl)=C1
Synonyms:
  • 6-Chloro-N-(1-methylethyl)-2-(methylsulfinyl)-4-pyrimidinamine
  • 4-Pyrimidinamine, 6-chloro-N-(1-methylethyl)-2-(methylsulfinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.