
CAS 1289386-66-8
:4-Piperidinamine, 1-[(3,4-dichlorophenyl)methyl]-, hydrochloride (1:1)
Description:
4-Piperidinamine, 1-[(3,4-dichlorophenyl)methyl]-, hydrochloride (1:1), with CAS number 1289386-66-8, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring, which contributes to its biological activity and potential pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in medicinal chemistry. The presence of the amine functional group suggests that it may participate in hydrogen bonding, influencing its interactions with biological targets. This compound may exhibit properties relevant to therapeutic applications, including potential use as an intermediate in drug synthesis or as a pharmacological agent. However, specific biological activities, toxicity, and safety profiles would require further investigation through empirical studies and literature review.
Formula:C12H16Cl2N2·ClH
InChI:InChI=1S/C12H16Cl2N2.ClH/c13-11-2-1-9(7-12(11)14)8-16-5-3-10(15)4-6-16;/h1-2,7,10H,3-6,8,15H2;1H
InChI key:InChIKey=STMVQKVMMBVBDB-UHFFFAOYSA-N
SMILES:C(C1=CC(Cl)=C(Cl)C=C1)N2CCC(N)CC2.Cl
Synonyms:- 4-Piperidinamine, 1-[(3,4-dichlorophenyl)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.