
CAS 1289386-90-8
:Piperidine, 4-[(2,6-dichlorophenyl)methoxy]-, hydrochloride (1:1)
Description:
Piperidine, 4-[(2,6-dichlorophenyl)methoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 2,6-dichlorophenyl group attached via a methoxy linkage, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of chlorine atoms on the phenyl ring may influence the compound's lipophilicity and biological interactions. This compound is of interest in medicinal chemistry, particularly for its potential use in drug development, as modifications to the piperidine structure can lead to variations in pharmacological effects. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity and environmental impact. Proper characterization through techniques such as NMR and mass spectrometry is crucial for confirming its structure and purity in research and industrial applications.
Formula:C12H15Cl2NO·ClH
InChI:InChI=1S/C12H15Cl2NO.ClH/c13-11-2-1-3-12(14)10(11)8-16-9-4-6-15-7-5-9;/h1-3,9,15H,4-8H2;1H
InChI key:InChIKey=FQSBGZAZWXDCRW-UHFFFAOYSA-N
SMILES:C(OC1CCNCC1)C2=C(Cl)C=CC=C2Cl.Cl
Synonyms:- Piperidine, 4-[(2,6-dichlorophenyl)methoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.