CAS 1289387-06-9
:1,1-Dimethylethyl N-[[1-[1-(2-pyridinyl)ethyl]-4-piperidinyl]methyl]carbamate
Description:
1,1-Dimethylethyl N-[[1-[1-(2-pyridinyl)ethyl]-4-piperidinyl]methyl]carbamate, identified by its CAS number 1289387-06-9, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a piperidine ring. This compound is typically classified as a pharmaceutical intermediate or a potential active pharmaceutical ingredient (API) due to its structural features that may confer biological activity. The presence of the pyridine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the compound's synthesis may involve specific reagents and conditions to ensure the desired purity and yield. Safety data, including toxicity and handling precautions, would be essential for laboratory work involving this substance, as with any chemical compound. Overall, 1,1-Dimethylethyl N-[[1-[1-(2-pyridinyl)ethyl]-4-piperidinyl]methyl]carbamate represents a unique entity in the realm of organic chemistry and pharmaceutical development.
Formula:C18H29N3O2
InChI:InChI=1S/C18H29N3O2/c1-14(16-7-5-6-10-19-16)21-11-8-15(9-12-21)13-20-17(22)23-18(2,3)4/h5-7,10,14-15H,8-9,11-13H2,1-4H3,(H,20,22)
InChI key:InChIKey=LBYCCMUITUMZQP-UHFFFAOYSA-N
SMILES:C(C)(N1CCC(CNC(OC(C)(C)C)=O)CC1)C2=CC=CC=N2
Synonyms:- 1,1-Dimethylethyl N-[[1-[1-(2-pyridinyl)ethyl]-4-piperidinyl]methyl]carbamate
- Carbamic acid, N-[[1-[1-(2-pyridinyl)ethyl]-4-piperidinyl]methyl]-, 1,1-dimethylethyl ester
- [1-(1-Pyridin-2-yl-ethyl)-piperidin-4-ylmethyl]-carbamic acid tert-butyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl ((1-(1-(pyridin-2-yl)ethyl)piperidin-4-yl)methyl)carbamate
CAS:Formula:C18H29N3O2Molecular weight:319.4418
