CAS 1289387-09-2

2-Piperidinemethanamine, 1-[1-(2-pyrazinyl)ethyl]-, hydrochloride (1:1)

Description:

2-Piperidinemethanamine, 1-[1-(2-pyrazinyl)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and pyrazine moieties, which contribute to its potential biological activity. The presence of the piperidine ring suggests that it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. The pyrazine group can enhance the compound's interaction with biological targets, potentially influencing its pharmacological profile. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals. The compound's structure indicates that it may be of interest in medicinal chemistry, particularly for developing agents with specific therapeutic effects. Its CAS number, 1289387-09-2, allows for precise identification in chemical databases, aiding in research and development efforts. Overall, this compound's unique structural features may contribute to its utility in various chemical and biological contexts.

Formula: C₁₂H₂₀N₄·ClH

InChI: InChI=1S/C12H20N4.ClH/c1-10(12-9-14-5-6-15-12)16-7-3-2-4-11(16)8-13;/h5-6,9-11H,2-4,7-8,13H2,1H3;1H

InChI key: InChIKey=MHOUHOXLTYSSDP-UHFFFAOYSA-N

SMILES: C(C)(N1C(CN)CCCC1)C=2C=NC=CN2.Cl

Synonyms:

• 2-Piperidinemethanamine, 1-[1-(2-pyrazinyl)ethyl]-, hydrochloride (1:1)