CAS 1289387-24-1

3-Piperidinamine, 1-(2-chloro-4-pyrimidinyl)-N-methyl-, hydrochloride (1:1)

Description:

3-Piperidinamine, 1-(2-chloro-4-pyrimidinyl)-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a chloro-substituted pyrimidine moiety contributes to its potential biological activity, particularly in medicinal chemistry. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in pharmaceutical formulations. The molecular structure suggests that it may exhibit properties relevant to drug development, possibly acting as an inhibitor or modulator in various biological pathways. Its specific interactions and efficacy would depend on the context of its application, including the target biological systems and conditions. As with many nitrogen-containing compounds, it may exhibit basic properties, allowing it to form salts with acids. Safety and handling precautions are essential, as with all chemical substances, particularly those with potential pharmacological effects. Further studies would be necessary to elucidate its full range of properties and applications.

Formula: C₁₀H₁₅ClN₄·ClH

InChI: InChI=1S/C10H15ClN4.ClH/c1-12-8-3-2-6-15(7-8)9-4-5-13-10(11)14-9;/h4-5,8,12H,2-3,6-7H2,1H3;1H

InChI key: InChIKey=QLHGYTAVYMKTJR-UHFFFAOYSA-N

SMILES: N(C)C1CN(CCC1)C2=NC(Cl)=NC=C2.Cl

Synonyms:

• 3-Piperidinamine, 1-(2-chloro-4-pyrimidinyl)-N-methyl-, hydrochloride (1:1)

1-(2-Chloropyrimidin-4-yl)-N-methylpiperidin-3-amine hydrochloride

CAS: 1289387-24-1

Formula: C₁₀H₁₆Cl₂N₄

Purity: 95%

Molecular weight: 263.1668

Ref: IN-DA000YMT

[1-(2-Chloro-pyrimidin-4-yl)-piperidin-3-yl]-methyl-amine hydrochloride

CAS: 1289387-24-1

Purity: 95.0%

Molecular weight: 263.1700134277344

Ref: 10-F090804