CymitQuimica logo

CAS 1289387-27-4

:

1,1-Dimethylethyl N-[1-[1-(2-thiazolyl)ethyl]-3-piperidinyl]carbamate

Description:
1,1-Dimethylethyl N-[1-[1-(2-thiazolyl)ethyl]-3-piperidinyl]carbamate, identified by its CAS number 1289387-27-4, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a thiazole ring, a piperidine moiety, and a tert-butyl group. The thiazole ring contributes to its potential biological activity, while the piperidine structure may influence its pharmacological properties. Typically, carbamates are known for their applications in agriculture as pesticides and in pharmaceuticals for their therapeutic effects. The specific characteristics of this compound, such as its solubility, stability, and reactivity, would depend on its molecular interactions and functional groups. Additionally, its safety profile, including toxicity and environmental impact, would require thorough investigation through experimental studies and regulatory assessments. Overall, this compound's unique structure suggests potential utility in various chemical and biological applications, warranting further research into its properties and effects.
Formula:C15H25N3O2S
InChI:InChI=1S/C15H25N3O2S/c1-11(13-16-7-9-21-13)18-8-5-6-12(10-18)17-14(19)20-15(2,3)4/h7,9,11-12H,5-6,8,10H2,1-4H3,(H,17,19)
InChI key:InChIKey=HVCIVELHPPBFAB-UHFFFAOYSA-N
SMILES:C(C)(N1CC(NC(OC(C)(C)C)=O)CCC1)C2=NC=CS2
Synonyms:
  • 1,1-Dimethylethyl N-[1-[1-(2-thiazolyl)ethyl]-3-piperidinyl]carbamate
  • Carbamic acid, N-[1-[1-(2-thiazolyl)ethyl]-3-piperidinyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.