CAS 1289387-33-2

Piperidine, 4-[[(2-chloro-6-fluorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[(2-chloro-6-fluorophenyl)methoxy]methyl]-, hydrochloride (1:1), identified by CAS number 1289387-33-2, is a chemical compound that features a piperidine ring, which is a six-membered saturated heterocyclic amine. This compound is characterized by the presence of a chloro and fluorine substituent on a phenyl group, linked through a methoxy methyl group to the piperidine nitrogen. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water and may influence its pharmacological properties. Typically, such compounds are of interest in medicinal chemistry due to their potential biological activity, including effects on the central nervous system. The presence of halogen atoms often contributes to the lipophilicity and reactivity of the molecule, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₃H₁₇ClFNO·ClH

InChI: InChI=1S/C13H17ClFNO.ClH/c14-12-2-1-3-13(15)11(12)9-17-8-10-4-6-16-7-5-10;/h1-3,10,16H,4-9H2;1H

InChI key: InChIKey=ZMELDABLKLRITN-UHFFFAOYSA-N

SMILES: C(OCC1CCNCC1)C2=C(Cl)C=CC=C2F.Cl

Synonyms:

• Piperidine, 4-[[(2-chloro-6-fluorophenyl)methoxy]methyl]-, hydrochloride (1:1)