CymitQuimica logo

CAS 1289387-39-8

:

1,1-Dimethylethyl N-methyl-N-[1-[1-(2-thiazolyl)ethyl]-3-piperidinyl]carbamate

Description:
1,1-Dimethylethyl N-methyl-N-[1-[1-(2-thiazolyl)ethyl]-3-piperidinyl]carbamate, identified by its CAS number 1289387-39-8, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a thiazole ring, a piperidine moiety, and a tert-butyl group. It is typically recognized for its potential applications in agricultural chemistry, particularly as a pesticide or herbicide, due to its ability to interact with biological systems. The compound may exhibit specific biological activities, including insecticidal or fungicidal properties, which are often evaluated through various assays. Its solubility, stability, and reactivity can vary based on environmental conditions, influencing its efficacy and safety profile. As with many chemical substances, proper handling and safety measures are essential, given the potential for toxicity or environmental impact. Further research and regulatory assessments are crucial to fully understand its characteristics and applications in various fields.
Formula:C16H27N3O2S
InChI:InChI=1S/C16H27N3O2S/c1-12(14-17-8-10-22-14)19-9-6-7-13(11-19)18(5)15(20)21-16(2,3)4/h8,10,12-13H,6-7,9,11H2,1-5H3
InChI key:InChIKey=SHDSHHFNMQFYBL-UHFFFAOYSA-N
SMILES:C(C)(N1CC(N(C(OC(C)(C)C)=O)C)CCC1)C2=NC=CS2
Synonyms:
  • Carbamic acid, N-methyl-N-[1-[1-(2-thiazolyl)ethyl]-3-piperidinyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl N-methyl-N-[1-[1-(2-thiazolyl)ethyl]-3-piperidinyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.