CAS 1289387-55-8

4-Piperidinemethanamine, N,N-bis[(3,4-dichlorophenyl)methyl]-, hydrochloride (1:1)

Description:

4-Piperidinemethanamine, N,N-bis[(3,4-dichlorophenyl)methyl]-, hydrochloride (1:1), with the CAS number 1289387-55-8, is a chemical compound characterized by its piperidine ring structure, which contributes to its potential biological activity. This substance features two 3,4-dichlorophenyl groups attached to a piperidinemethanamine backbone, indicating a significant degree of chlorination that may influence its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its usability in various applications, particularly in pharmaceutical formulations. The presence of the piperidine moiety suggests potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is handled. Safety data and handling precautions should be observed, as with any chemical compound, particularly those with potential biological activity.

Formula: C₂₀H₂₂Cl₄N₂·ClH

InChI: InChI=1S/C20H22Cl4N2.ClH/c21-17-3-1-15(9-19(17)23)12-26(11-14-5-7-25-8-6-14)13-16-2-4-18(22)20(24)10-16;/h1-4,9-10,14,25H,5-8,11-13H2;1H

InChI key: InChIKey=ZZCYDGBJLHSXKU-UHFFFAOYSA-N

SMILES: N(CC1=CC(Cl)=C(Cl)C=C1)(CC2=CC(Cl)=C(Cl)C=C2)CC3CCNCC3.Cl

Synonyms:

• 4-Piperidinemethanamine, N,N-bis[(3,4-dichlorophenyl)methyl]-, hydrochloride (1:1)