CAS 1289387-66-1

3-Piperidinamine, 1-[(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:1)

Description:

3-Piperidinamine, 1-[(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:1), with the CAS number 1289387-66-1, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a chloro and fluorine substitution on a phenyl group, contributing to its potential biological activity. The hydrochloride salt form indicates that it is a hydrochloride, which typically enhances solubility in water and may influence its pharmacokinetic properties. The presence of the piperidinamine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its structural characteristics may allow for interactions with specific receptors or enzymes, making it a candidate for further research in drug development. As with many compounds, safety and handling precautions should be observed, and its properties should be evaluated in the context of its intended use.

Formula: C₁₂H₁₆ClFN₂·ClH

InChI: InChI=1S/C12H16ClFN2.ClH/c13-11-4-1-5-12(14)10(11)8-16-6-2-3-9(15)7-16;/h1,4-5,9H,2-3,6-8,15H2;1H

InChI key: InChIKey=DGFBORPDXJDTJO-UHFFFAOYSA-N

SMILES: C(C1=C(Cl)C=CC=C1F)N2CC(N)CCC2.Cl

Synonyms:

• 3-Piperidinamine, 1-[(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:1)