CymitQuimica logo

CAS 1289387-67-2

:

1,1-Dimethylethyl 2-(chloromethyl)-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 2-(chloromethyl)-1-piperidinecarboxylate, identified by its CAS number 1289387-67-2, is a chemical compound that features a piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound is characterized by the presence of a chloromethyl group and a tert-butyl group, contributing to its unique reactivity and potential applications in organic synthesis. The ester functional group in its structure suggests that it can undergo hydrolysis, transesterification, or other reactions typical of esters. Its molecular structure indicates that it may exhibit moderate polarity, influencing its solubility in various solvents. Additionally, the presence of the chloromethyl group may impart reactivity towards nucleophiles, making it a useful intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the potential reactivity of the chloromethyl group and the overall toxicity associated with piperidine derivatives. As with many chemical substances, further studies would be necessary to fully understand its properties and potential applications in pharmaceuticals or agrochemicals.
Formula:C11H20ClNO2
InChI:InChI=1S/C11H20ClNO2/c1-11(2,3)15-10(14)13-7-5-4-6-9(13)8-12/h9H,4-8H2,1-3H3
InChI key:InChIKey=NJEQIEAONVBZAW-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C(CCl)CCCC1
Synonyms:
  • 1,1-Dimethylethyl 2-(chloromethyl)-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 2-(chloromethyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.