CAS 1289387-73-0

Pyrazine, 2-[1-(3-methyl-1-piperazinyl)ethyl]-, hydrochloride (1:1)

Description:

Pyrazine, 2-[1-(3-methyl-1-piperazinyl)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a pyrazine ring and a piperazine moiety. This substance typically appears as a white to off-white crystalline powder and is soluble in water, indicating its ionic nature due to the presence of the hydrochloride salt. The compound is often studied for its potential pharmacological properties, particularly in the field of medicinal chemistry, where derivatives of piperazine are known for their diverse biological activities. Its molecular structure suggests that it may interact with various biological targets, making it of interest in drug development. Additionally, the presence of the hydrochloride form enhances its stability and solubility, which are critical for formulation in pharmaceutical applications. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural features in determining biological activity.

Formula: C₁₁H₁₈N₄·ClH

InChI: InChI=1S/C11H18N4.ClH/c1-9-8-15(6-5-13-9)10(2)11-7-12-3-4-14-11;/h3-4,7,9-10,13H,5-6,8H2,1-2H3;1H

InChI key: InChIKey=WIJMFUIYNDNRDW-UHFFFAOYSA-N

SMILES: C(C)(N1CC(C)NCC1)C=2C=NC=CN2.Cl

Synonyms:

• Pyrazine, 2-[1-(3-methyl-1-piperazinyl)ethyl]-, hydrochloride (1:1)