CymitQuimica logo

CAS 1289387-76-3

:

1-(4-Chloro-5-methyl-2-pyrimidinyl)-3-azetidinecarboxylic acid

Description:
1-(4-Chloro-5-methyl-2-pyrimidinyl)-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a chlorine atom and a methyl group, as well as an azetidine ring that contains a carboxylic acid functional group. This compound is typically classified as a heterocyclic organic compound due to the presence of nitrogen atoms in both the pyrimidine and azetidine rings. The chlorine substituent can influence the compound's reactivity and biological activity, while the carboxylic acid group contributes to its acidity and potential for forming salts or esters. Such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of multiple functional groups suggests potential for diverse chemical reactivity, including nucleophilic substitutions and coupling reactions. Overall, this compound's structural features may lend it utility in various applications, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C9H10ClN3O2
InChI:InChI=1S/C9H10ClN3O2/c1-5-2-11-9(12-7(5)10)13-3-6(4-13)8(14)15/h2,6H,3-4H2,1H3,(H,14,15)
InChI key:InChIKey=WWSBGRUPWRRDQZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CN(C1)C=2N=C(Cl)C(C)=CN2
Synonyms:
  • 1-(4-Chloro-5-methyl-2-pyrimidinyl)-3-azetidinecarboxylic acid
  • 3-Azetidinecarboxylic acid, 1-(4-chloro-5-methyl-2-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.