CAS 1289387-86-5

Piperidine, 3-[[(2,5-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[[(2,5-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 2,5-dichlorophenyl group indicates that the compound has significant aromatic characteristics, contributing to its potential biological activity. The methoxy group attached to the phenyl ring enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as analgesic or psychoactive effects, depending on its specific interactions with biological systems. Its molecular structure suggests potential for use in medicinal chemistry, particularly in the development of new therapeutic agents. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₁₃H₁₇Cl₂NO·ClH

InChI: InChI=1S/C13H17Cl2NO.ClH/c14-12-3-4-13(15)11(6-12)9-17-8-10-2-1-5-16-7-10;/h3-4,6,10,16H,1-2,5,7-9H2;1H

InChI key: InChIKey=HGFIMRXJMHALBP-UHFFFAOYSA-N

SMILES: C(OCC1CCCNC1)C2=C(Cl)C=CC(Cl)=C2.Cl

Synonyms:

• Piperidine, 3-[[(2,5-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)