CAS 1289387-98-9

2,6-Dichloro-N-cyclopropyl-4-pyrimidinemethanamine

Description:

2,6-Dichloro-N-cyclopropyl-4-pyrimidinemethanamine is a chemical compound characterized by its pyrimidine ring structure, which is substituted at the 2 and 6 positions with chlorine atoms. The presence of a cyclopropyl group at the nitrogen atom contributes to its unique properties, potentially influencing its biological activity and reactivity. This compound is likely to exhibit polar characteristics due to the presence of the amine functional group, which can engage in hydrogen bonding. The dichloro substitutions may enhance its lipophilicity, affecting its solubility in various solvents. As a pyrimidine derivative, it may possess pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The specific interactions and stability of this compound can be influenced by its molecular structure, making it a subject of study in various chemical and biological applications. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₈H₉Cl₂N₃

InChI: InChI=1S/C8H9Cl2N3/c9-7-3-6(12-8(10)13-7)4-11-5-1-2-5/h3,5,11H,1-2,4H2

InChI key: InChIKey=ZURSGPRGPGZSLN-UHFFFAOYSA-N

SMILES: C(NC1CC1)C=2C=C(Cl)N=C(Cl)N2

Synonyms:

• 4-Pyrimidinemethanamine, 2,6-dichloro-N-cyclopropyl-
• 2,6-Dichloro-N-cyclopropyl-4-pyrimidinemethanamine