CAS 1289388-03-9
:2-Chloro-N-(1-methylethyl)-5-thiazolemethanamine
Description:
2-Chloro-N-(1-methylethyl)-5-thiazolemethanamine is a chemical compound characterized by its thiazole ring, which contributes to its heterocyclic nature. The presence of a chlorine atom and an isopropyl group (1-methylethyl) on the nitrogen atom influences its reactivity and solubility properties. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its thiazole structure is known for imparting various pharmacological properties, including antimicrobial and antifungal activities. The chlorine substituent can enhance lipophilicity, affecting the compound's interaction with biological membranes. Additionally, the compound's amine functional group may participate in hydrogen bonding, influencing its solubility in polar solvents. Safety and handling precautions are essential, as with many halogenated compounds, due to potential toxicity and environmental impact. Overall, 2-Chloro-N-(1-methylethyl)-5-thiazolemethanamine represents a unique structure with potential applications in medicinal chemistry and material science.
Formula:C7H11ClN2S
InChI:InChI=1S/C7H11ClN2S/c1-5(2)9-3-6-4-10-7(8)11-6/h4-5,9H,3H2,1-2H3
InChI key:InChIKey=SMJHBQKLFJQYMR-UHFFFAOYSA-N
SMILES:C(NC(C)C)C=1SC(Cl)=NC1
Synonyms:- [(2-Chloro-1,3-thiazol-5-yl)methyl](propan-2-yl)amine
- (2-Chloro-thiazol-5-ylmethyl)-isopropyl-amine
- 5-Thiazolemethanamine, 2-chloro-N-(1-methylethyl)-
- 2-Chloro-N-(1-methylethyl)-5-thiazolemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
