
CAS 1289388-04-0
:4-Piperidinamine, 1-[(3,4-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1)
Description:
4-Piperidinamine, 1-[(3,4-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a dichlorophenyl group indicates that the compound has significant aromatic characteristics, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, although detailed biological activity would depend on further studies. The molecular structure suggests that it may interact with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity. Proper storage conditions and stability considerations are also essential for maintaining the integrity of the compound.
Formula:C13H18Cl2N2·ClH
InChI:InChI=1S/C13H18Cl2N2.ClH/c1-16-11-4-6-17(7-5-11)9-10-2-3-12(14)13(15)8-10;/h2-3,8,11,16H,4-7,9H2,1H3;1H
InChI key:InChIKey=CONWTXRZJFGRAR-UHFFFAOYSA-N
SMILES:C(C1=CC(Cl)=C(Cl)C=C1)N2CCC(NC)CC2.Cl
Synonyms:- 4-Piperidinamine, 1-[(3,4-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.