CAS 1289388-06-2
:1-[(2,5-Dichlorophenyl)methyl]-2-piperidinemethanol
Description:
1-[(2,5-Dichlorophenyl)methyl]-2-piperidinemethanol, identified by its CAS number 1289388-06-2, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with a 2,5-dichlorophenyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the dichlorophenyl moiety may enhance lipophilicity and influence interactions with biological targets, while the piperidine ring can impart basicity and potential for forming hydrogen bonds. The hydroxymethyl group suggests the possibility of further functionalization or reactivity, making it of interest in medicinal chemistry. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound may have implications in pharmacology and material science, warranting further investigation into its properties and potential applications.
Formula:C13H17Cl2NO
InChI:InChI=1S/C13H17Cl2NO/c14-11-4-5-13(15)10(7-11)8-16-6-2-1-3-12(16)9-17/h4-5,7,12,17H,1-3,6,8-9H2
InChI key:InChIKey=NCPWAVVWGPABNV-UHFFFAOYSA-N
SMILES:C(N1C(CO)CCCC1)C2=C(Cl)C=CC(Cl)=C2
Synonyms:- 2-Piperidinemethanol, 1-[(2,5-dichlorophenyl)methyl]-
- 1-[(2,5-Dichlorophenyl)methyl]-2-piperidinemethanol
- [1-(2,5-Dichloro-benzyl)-piperidin-2-yl]-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.