CymitQuimica logo

CAS 1289388-14-2

:

1-(4,6-Dimethyl-2-pyrimidinyl)-3-azetidinecarboxylic acid

Description:
1-(4,6-Dimethyl-2-pyrimidinyl)-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and an azetidine ring. The presence of the dimethyl groups on the pyrimidine contributes to its lipophilicity and potential biological activity. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The azetidine ring introduces a cyclic amine structure, which may affect its conformational flexibility and interactions with biological targets. Given its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as it could interact with specific biological pathways or receptors. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be further explored through various analytical methods, including NMR and mass spectrometry. Overall, this compound represents a potentially valuable scaffold for further research and development in chemical and pharmaceutical applications.
Formula:C10H13N3O2
InChI:InChI=1S/C10H13N3O2/c1-6-3-7(2)12-10(11-6)13-4-8(5-13)9(14)15/h3,8H,4-5H2,1-2H3,(H,14,15)
InChI key:InChIKey=SZMBJDSWVDDJHW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CN(C1)C=2N=C(C)C=C(C)N2
Synonyms:
  • 3-Azetidinecarboxylic acid, 1-(4,6-dimethyl-2-pyrimidinyl)-
  • 1-(4,6-Dimethyl-2-pyrimidinyl)-3-azetidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.