
CAS 1289388-15-3
:Piperazine, 3-methyl-1-[1-(2-thiazolyl)ethyl]-, hydrochloride (1:1)
Description:
Piperazine, 3-methyl-1-[1-(2-thiazolyl)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a methyl group at the 3-position and a thiazole ring substituted at the 1-position, contributing to its unique pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for potential therapeutic applications. The thiazole moiety is known for its role in various biological activities, including antimicrobial and antifungal properties. The compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions of use and formulation. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with exposure. Further research may elucidate its full range of biological activities and potential applications in pharmaceuticals.
Formula:C10H17N3S·ClH
InChI:InChI=1S/C10H17N3S.ClH/c1-8-7-13(5-3-11-8)9(2)10-12-4-6-14-10;/h4,6,8-9,11H,3,5,7H2,1-2H3;1H
InChI key:InChIKey=YFFYRXAOUHIREY-UHFFFAOYSA-N
SMILES:C(C)(N1CC(C)NCC1)C2=NC=CS2.Cl
Synonyms:- Piperazine, 3-methyl-1-[1-(2-thiazolyl)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(1-(3-Methylpiperazin-1-yl)ethyl)thiazole hydrochloride
CAS:Formula:C10H18ClN3SMolecular weight:247.7880
