CAS 1289388-16-4
:1,1-Dimethylethyl 3-[[[1-(2-pyrazinyl)ethyl]amino]methyl]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 3-[[[1-(2-pyrazinyl)ethyl]amino]methyl]-1-piperidinecarboxylate, identified by its CAS number 1289388-16-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyrazine moiety. This compound typically exhibits properties associated with both amines and esters, suggesting potential solubility in organic solvents and moderate polarity. The presence of the dimethyl group contributes to steric hindrance, which may influence its reactivity and interaction with biological targets. Additionally, the pyrazine ring may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's functionality allows for potential applications in drug development, particularly in the design of agents targeting neurological or cardiovascular systems. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its structure and purity. Overall, this compound represents a unique scaffold that could be explored for various therapeutic applications.
Formula:C17H28N4O2
InChI:InChI=1S/C17H28N4O2/c1-13(15-11-18-7-8-19-15)20-10-14-6-5-9-21(12-14)16(22)23-17(2,3)4/h7-8,11,13-14,20H,5-6,9-10,12H2,1-4H3
InChI key:InChIKey=KAWJOCDWQLGMAB-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(CNC(C)C=2C=NC=CN2)CCC1
Synonyms:- 1,1-Dimethylethyl 3-[[[1-(2-pyrazinyl)ethyl]amino]methyl]-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 3-[[[1-(2-pyrazinyl)ethyl]amino]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 3-(((1-(pyrazin-2-yl)ethyl)amino)methyl)piperidine-1-carboxylate
CAS:Formula:C17H28N4O2Molecular weight:320.4298
