CAS 1289388-27-7

4-Pyridinecarbonitrile, 2-(2-piperidinylmethoxy)-, hydrochloride (1:1)

Description:

4-Pyridinecarbonitrile, 2-(2-piperidinylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and piperidine functional groups, which contribute to its potential biological activity. The presence of the pyridine ring suggests that it may exhibit properties typical of heterocyclic compounds, such as the ability to participate in various chemical reactions and interactions. The piperidine moiety enhances its solubility and may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its CAS number, 1289388-27-7, allows for precise identification in chemical databases. However, specific data regarding its toxicity, biological activity, and applications would require further investigation through scientific literature and experimental studies.

Formula: C₁₂H₁₅N₃O·ClH

InChI: InChI=1S/C12H15N3O.ClH/c13-8-10-4-6-15-12(7-10)16-9-11-3-1-2-5-14-11;/h4,6-7,11,14H,1-3,5,9H2;1H

InChI key: InChIKey=VXRSMDNWMFUEBC-UHFFFAOYSA-N

SMILES: O(CC1CCCCN1)C2=CC(C#N)=CC=N2.Cl

Synonyms:

• 4-Pyridinecarbonitrile, 2-(2-piperidinylmethoxy)-, hydrochloride (1:1)