CAS 1289388-41-5

Pyrimidine, 4-chloro-6-(2-methyl-1-piperazinyl)-, hydrochloride (1:1)

Description:

Pyrimidine, 4-chloro-6-(2-methyl-1-piperazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 4-position and a 2-methyl-1-piperazinyl group at the 6-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications in drug development.

Formula: C₉H₁₃ClN₄·ClH

InChI: InChI=1S/C9H13ClN4.ClH/c1-7-5-11-2-3-14(7)9-4-8(10)12-6-13-9;/h4,6-7,11H,2-3,5H2,1H3;1H

InChI key: InChIKey=ODXPNLCZQMLSRD-UHFFFAOYSA-N

SMILES: CC1N(C=2C=C(Cl)N=CN2)CCNC1.Cl

Synonyms:

• 4-Chloro-6-(2-methyl-piperazin-1-yl)-pyrimidine hydrochloride
• Pyrimidine, 4-chloro-6-(2-methyl-1-piperazinyl)-, hydrochloride (1:1)