CAS 1289388-46-0
:1,1-Dimethylethyl 3-[(6-methyl-3-pyridazinyl)oxy]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 3-[(6-methyl-3-pyridazinyl)oxy]-1-piperidinecarboxylate, identified by its CAS number 1289388-46-0, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and a pyridazine moiety, indicating potential biological activity due to the heteroatoms in its structure. The ester functional group is present, suggesting it may exhibit properties typical of esters, such as volatility and reactivity with nucleophiles. The presence of the pyridazine ring may contribute to its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's structure implies potential for interactions with biological targets, which could be explored in drug development. Overall, its unique combination of functional groups and ring structures may confer specific chemical reactivity and biological activity, warranting further investigation in relevant applications.
Formula:C15H23N3O3
InChI:InChI=1S/C15H23N3O3/c1-11-7-8-13(17-16-11)20-12-6-5-9-18(10-12)14(19)21-15(2,3)4/h7-8,12H,5-6,9-10H2,1-4H3
InChI key:InChIKey=GPQCPTOIJOGTHN-UHFFFAOYSA-N
SMILES:O(C1CN(C(OC(C)(C)C)=O)CCC1)C2=CC=C(C)N=N2
Synonyms:- 1,1-Dimethylethyl 3-[(6-methyl-3-pyridazinyl)oxy]-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 3-[(6-methyl-3-pyridazinyl)oxy]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 3-((6-methylpyridazin-3-yl)oxy)piperidine-1-carboxylate
CAS:Formula:C15H23N3O3Molecular weight:293.3614
