CAS 1289388-49-3

Piperidine, 3-[(5-thiazolylmethoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[(5-thiazolylmethoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen, contributes to its unique properties and potential biological activity. The methoxy group attached to the thiazole enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit pharmacological properties, potentially acting as a ligand or modulator in biological systems. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₀H₁₆N₂OS·ClH

InChI: InChI=1S/C10H16N2OS.ClH/c1-2-9(4-11-3-1)6-13-7-10-5-12-8-14-10;/h5,8-9,11H,1-4,6-7H2;1H

InChI key: InChIKey=SAEWSLBLFOLCNH-UHFFFAOYSA-N

SMILES: C(OCC1CCCNC1)C2=CN=CS2.Cl

Synonyms:

• Piperidine, 3-[(5-thiazolylmethoxy)methyl]-, hydrochloride (1:1)