CymitQuimica logo

CAS 1289388-56-2

:

1,1-Dimethylethyl 4-[[(4-chlorophenyl)sulfonyl]methyl]-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-[[(4-chlorophenyl)sulfonyl]methyl]-1-piperidinecarboxylate, with CAS number 1289388-56-2, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a sulfonyl group, and a tert-butyl substituent. This compound typically exhibits properties associated with both lipophilicity and polar functional groups, making it soluble in organic solvents while potentially having limited solubility in water. The presence of the sulfonyl group suggests that it may participate in various chemical reactions, including nucleophilic substitutions. Additionally, the chlorophenyl moiety can influence the compound's biological activity, potentially enhancing its interaction with specific biological targets. As a piperidine derivative, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. Overall, the compound's unique structural features contribute to its potential applications in pharmaceuticals or agrochemicals, although specific biological or chemical activity would require further investigation.
Formula:C17H24ClNO4S
InChI:InChI=1S/C17H24ClNO4S/c1-17(2,3)23-16(20)19-10-8-13(9-11-19)12-24(21,22)15-6-4-14(18)5-7-15/h4-7,13H,8-12H2,1-3H3
InChI key:InChIKey=GRQGZWDMDLUAPY-UHFFFAOYSA-N
SMILES:S(CC1CCN(C(OC(C)(C)C)=O)CC1)(=O)(=O)C2=CC=C(Cl)C=C2
Synonyms:
  • 1,1-Dimethylethyl 4-[[(4-chlorophenyl)sulfonyl]methyl]-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 4-[[(4-chlorophenyl)sulfonyl]methyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.